Boronic acid derivatives
eMolecules 126747-14-6 | 4-Cyanophenylboronic acid | Combi-Blocks | MFCD01318968 | 146.940 | C7H6BNO2 | 98.000 | OB(O)c1ccc(cc1)C#N | 500g | 357557801
4-Cyanophenylboronic acid | Combi-Blocks | 126747-14-6 | MFCD01318968 | 146.940 | C7H6BNO2 | 98.000 | OB(O)c1ccc(cc1)C#N | 500g | 357557801
Aobchem 4-Cyano-3-ethylphenylboronic acid pinacol ester | ≥97% | CAS 2121513-53-7 | C15H20BNO2 | 1g
4-Cyano-3-ethylphenylboronic acid pinacol ester | ≥97% | CAS 2121513-53-7 | C15H20BNO2 | 1g
Aobchem 3-Borono-2-ethoxyphenylboronic acid | 95% | C9H11BO5 | 1g
3-Borono-2-ethoxyphenylboronic acid | 95% | C9H11BO5 | 1g
eMolecules 1072945-92-6 | 1-p-Tolylpyrazole-4-boronic acid | Combi-Blocks | MFCD09972102 | 202.020 | C10H11BN2O2 | 98.000 | Cc1ccc(cc1)-n1cc(cn1)B(O)O | 1g | 117523684
1-p-Tolylpyrazole-4-boronic acid | Combi-Blocks | 1072945-92-6 | MFCD09972102 | 202.020 | C10H11BN2O2 | 98.000 | Cc1ccc(cc1)-n1cc(cn1)B(O)O | 1g | 117523684
Aobchem 2-Bromo-3-fluorophenylboronic acid pinacol ester | 97% | C12H15BBrFO2 | 250mg
2-Bromo-3-fluorophenylboronic acid pinacol ester | 97% | C12H15BBrFO2 | 250mg
Aobchem 2-(6-(2 2 2-Trifluoroethoxy)pyridin-3-yl)propan-2-ol | 95% | C10H12F3NO2 | 250mg
2-(6-(2 2 2-Trifluoroethoxy)pyridin-3-yl)propan-2-ol | 95% | C10H12F3NO2 | 250mg
Cayman Chemical 9OxoOTrE Fatty Acids and Deriv
9-OxoOTrE is produced by the oxidation of 9-HpOTrE.{14394} 9-OxoOTrE exhibits antimicrobial activity against plant pathogenic microorganisms including bacteria and fungi.{14395}
Frontier Specialty Chemicals 5G 1-N-BOC-PYRROLE-2-BORONIC A
1-N-Boc-pyrrole-2-boronic acid; CAS No: 135884-31-0
Cayman Chemical 19 SHETE Fatty Acids and Deriv
Potent vasodilator of renal preglomerular vessels; 70% of the metabolite composition of arachidonic acid by CYP2E1; stimulates both renal sodium-potassium ATPase and volume absorption in the rabbit proximal straight tubule
eMolecules 725251-81-0 | 3-Methoxy-5-methylphenylboronic acid | Combi-Blocks | MFCD09952026 | 165.980 | C8H11BO3 | 98.000 | COc1cc(C)cc(c1)B(O)O | 1g | 117524062
3-Methoxy-5-methylphenylboronic acid | Combi-Blocks | 725251-81-0 | MFCD09952026 | 165.980 | C8H11BO3 | 98.000 | COc1cc(C)cc(c1)B(O)O | 1g | 117524062
Chemscene ChemScene | 2-Ethoxyphenylboronic acid | 25G | CS-W016068 | 0.98 | 213211-69-9| MFCD00674027 | 165.99
ChemScene | 2-Ethoxyphenylboronic acid | 25G | CS-W016068 | 0.98 | 213211-69-9| MFCD00674027 | 165.99
Frontier Specialty Chemicals 5G 3-(N-BOC-AMINOMETHYL)PHENYL
3-((N-Boc-amino)methyl)phenylboronic acid; CAS No: 199609-62-6
eMolecules Ambeed | 2-Methyl-5-(4455-tetramethyl-132-dioxaborolan-2-yl)pyridine hydrochloride | 250mg | 752810340 | A1694759 | 255.55 | C12H19BClNO2
Ambeed | 2-Methyl-5-(4455-tetramethyl-132-dioxaborolan-2-yl)pyridine hydrochloride | 250mg | 752810340 | A1694759 | | 255.550 | C12H19BClNO2