Boronic acid derivatives
eMolecules 51851-79-7 | Diisopropyl allylboronate | Combi-Blocks | MFCD15072157 | 170.060 | C9H19BO2 | 95.000 | CC(C)OB(CC=C)OC(C)C | 1g | 267203938
Diisopropyl allylboronate | Combi-Blocks | 51851-79-7 | MFCD15072157 | 170.060 | C9H19BO2 | 95.000 | CC(C)OB(CC=C)OC(C)C | 1g | 267203938
=O | 1g | 117545572](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502190549.JPG-250.jpg)
eMolecules 1218791-28-6 | 2-Cyano-5-nitrophenylboronic acid, pinacol ester | Combi-Blocks | MFCD12546472 | 274.080 | C13H15BN2O4 | 97.000 | CC1(C)OB(OC1(C)C)c1cc(ccc1C#N)[N+]([O-])=O | 1g | 117545572
2-Cyano-5-nitrophenylboronic acid, pinacol ester | Combi-Blocks | 1218791-28-6 | MFCD12546472 | 274.080 | C13H15BN2O4 | 97.000 | CC1(C)OB(OC1(C)C)c1cc(ccc1C#N)[N+]([O-])=O | 1g | 117545572
eMolecules 1104636-67-0 | 4-BIPHENYLBORONIC ACID MIDA ESTER | MFCD25976531 | 5g
Medchem Express | Blumeatin | 5mg | 582658863 | HY-N2358 | 118024-26-3 | MFCD20274981 | 302.282 | C16H14O6
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Chem-Impex International, Inc. 3-Methoxyphenylboronic acid | MFCD00161359 | 25G
3-Methoxyphenylboronic acid, MFCD00161359, 25G
Chemscene ChemScene | 4-(N-Methylaminocarbonyl)phenylboronic acid | 5G | CS-W022019 | 0.98 | 121177-82-0| MFCD03788427 | 178.98
ChemScene | 4-(N-Methylaminocarbonyl)phenylboronic acid | 5G | CS-W022019 | 0.98 | 121177-82-0| MFCD03788427 | 178.98
Chem-Impex International, Inc. 2-Nitrophenylboronic acid | MFCD00161358 | 1G
2-Nitrophenylboronic acid, MFCD00161358, 1G
![eMolecules 851524-97-5 | 9H-Carbazol-3-ylboronic acid | Combi-Blocks, Inc. | MFCD04113810 | 211.030 | C12H10BNO2 | 95.000 | OB(O)c1ccc2[nH]c3ccccc3c2c1 | 1g | 603134072](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502189633.JPG-250.jpg)
eMolecules 851524-97-5 | 9H-Carbazol-3-ylboronic acid | Combi-Blocks, Inc. | MFCD04113810 | 211.030 | C12H10BNO2 | 95.000 | OB(O)c1ccc2[nH]c3ccccc3c2c1 | 1g | 603134072
9H-Carbazol-3-ylboronic acid | Combi-Blocks, Inc. | 851524-97-5 | MFCD04113810 | 211.030 | C12H10BNO2 | 95.000 | OB(O)c1ccc2[nH]c3ccccc3c2c1 | 1g | 603134072
eMolecules 74924-94-0 | 4-BROMONAPHTHALEN-2-AMINE | MFCD17012399 | 1g
AstaTech | 4-BROMONAPHTHALEN-2-AMINE | 1g | 573027371 | O11192 | 95.000 | 74924-94-0 | MFCD17012399 | 222.085 | C10H8BrN
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>